C23H52OSi4 — CID 101176149
tert-butyl-[(2,3-ditert-butylcycloprop-2-en-1-yl)-bis(trimethylsilyl)silyl]oxy-dimethylsilane (PubChem CID 101176149) has the molecular formula C23H52OSi4 and a molecular weight of 457.01 g/mol. Its IUPAC name is tert-butyl-[(2,3-ditert-butylcycloprop-2-en-1-yl)-bis(trimethylsilyl)silyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2,3-ditert-butylcycloprop-2-en-1-yl)-bis(trimethylsilyl)silyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 101176149 |
| Molecular Formula | C23H52OSi4 |
| Molecular Weight | 457.01 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | tert-butyl-[(2,3-ditert-butylcycloprop-2-en-1-yl)-bis(trimethylsilyl)silyl]oxy-dimethylsilane |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)C1[Si](O[Si](C)(C)C(C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C23H52OSi4/c1-21(2,3)18-19(22(4,5)6)20(18)28(25(10,11)12,26(13,14)15)24-27(16,17)23(7,8)9/h20H,1-17H3 |
| InChIKey | NFTDSZMEYBQLDK-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.01 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|