C13H25FO3Si — CID 101176670
ethyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoropent-3-enoate (PubChem CID 101176670) has the molecular formula C13H25FO3Si and a molecular weight of 276.42 g/mol. Its IUPAC name is ethyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoropent-3-enoate.
| Compound Name | ethyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoropent-3-enoate |
|---|---|
| PubChem CID | 101176670 |
| Molecular Formula | C13H25FO3Si |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | ethyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoropent-3-enoate |
| SMILES | CCOC(=O)C(F)/C=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H25FO3Si/c1-7-16-12(15)11(14)9-8-10-17-18(5,6)13(2,3)4/h8-9,11H,7,10H2,1-6H3/b9-8+ |
| InChIKey | WWABBHVWKZVBRL-CMDGGOBGSA-N |
| XLogP | 3.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|