C13H26O2Si — CID 102486407
[(E)-5-trimethylsilylpent-3-enyl] 2,2-dimethylpropanoate (PubChem CID 102486407) has the molecular formula C13H26O2Si and a molecular weight of 242.43 g/mol. Its IUPAC name is [(E)-5-trimethylsilylpent-3-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E)-5-trimethylsilylpent-3-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102486407 |
| Molecular Formula | C13H26O2Si |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | [(E)-5-trimethylsilylpent-3-enyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC/C=C/C[Si](C)(C)C |
| InChI | InChI=1S/C13H26O2Si/c1-13(2,3)12(14)15-10-8-7-9-11-16(4,5)6/h7,9H,8,10-11H2,1-6H3/b9-7+ |
| InChIKey | WGERGXDWMHFRFE-VQHVLOKHSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|