C12H24F12Si6 — CID 101176911
1,1,4,4,7,7,10,10,13,13,16,16-dodecafluoro-1,4,7,10,13,16-hexasilacyclooctadecane (PubChem CID 101176911) has the molecular formula C12H24F12Si6 and a molecular weight of 564.82 g/mol. Its IUPAC name is 1,1,4,4,7,7,10,10,13,13,16,16-dodecafluoro-1,4,7,10,13,16-hexasilacyclooctadecane.
| Compound Name | 1,1,4,4,7,7,10,10,13,13,16,16-dodecafluoro-1,4,7,10,13,16-hexasilacyclooctadecane |
|---|---|
| PubChem CID | 101176911 |
| Molecular Formula | C12H24F12Si6 |
| Molecular Weight | 564.82 g/mol |
| Exact Mass | 564.03 |
| IUPAC Name | 1,1,4,4,7,7,10,10,13,13,16,16-dodecafluoro-1,4,7,10,13,16-hexasilacyclooctadecane |
| SMILES | F[Si]1(F)CC[Si](F)(F)CC[Si](F)(F)CC[Si](F)(F)CC[Si](F)(F)CC[Si](F)(F)CC1 |
| InChI | InChI=1S/C12H24F12Si6/c13-25(14)1-2-26(15,16)5-6-28(19,20)9-10-30(23,24)12-11-29(21,22)8-7-27(17,18)4-3-25/h1-12H2 |
| InChIKey | NKCSLYVOGCXLGS-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.82 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|