C25H19N7 — CID 101177533
2-N,2-N,6-N,6-N-tetrapyridin-2-ylpyridine-2,6-diamine (PubChem CID 101177533) has the molecular formula C25H19N7 and a molecular weight of 417.48 g/mol. Its IUPAC name is 2-N,2-N,6-N,6-N-tetrapyridin-2-ylpyridine-2,6-diamine.
| Compound Name | 2-N,2-N,6-N,6-N-tetrapyridin-2-ylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 101177533 |
| Molecular Formula | C25H19N7 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 2-N,2-N,6-N,6-N-tetrapyridin-2-ylpyridine-2,6-diamine |
| SMILES | c1ccc(N(c2ccccn2)c2cccc(N(c3ccccn3)c3ccccn3)n2)nc1 |
| InChI | InChI=1S/C25H19N7/c1-5-16-26-20(10-1)31(21-11-2-6-17-27-21)24-14-9-15-25(30-24)32(22-12-3-7-18-28-22)23-13-4-8-19-29-23/h1-19H |
| InChIKey | BUDKFHMJNFAKHI-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 70.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |