C44H32O6 — CID 101177604
methyl (6Z)-6-(8-methoxycarbonyl-1,12-dimethyl-5-oxobenzo[c]phenanthren-6-ylidene)-1,12-dimethyl-5-oxobenzo[c]phenanthrene-8-carboxylate (PubChem CID 101177604) has the molecular formula C44H32O6 and a molecular weight of 656.73 g/mol. Its IUPAC name is methyl (6Z)-6-(8-methoxycarbonyl-1,12-dimethyl-5-oxobenzo[c]phenanthren-6-ylidene)-1,12-dimethyl-5-oxobenzo[c]phenanthrene-8-carboxylate.
| Compound Name | methyl (6Z)-6-(8-methoxycarbonyl-1,12-dimethyl-5-oxobenzo[c]phenanthren-6-ylidene)-1,12-dimethyl-5-oxobenzo[c]phenanthrene-8-carboxylate |
|---|---|
| PubChem CID | 101177604 |
| Molecular Formula | C44H32O6 |
| Molecular Weight | 656.73 g/mol |
| Exact Mass | 656.22 |
| IUPAC Name | methyl (6Z)-6-(8-methoxycarbonyl-1,12-dimethyl-5-oxobenzo[c]phenanthren-6-ylidene)-1,12-dimethyl-5-oxobenzo[c]phenanthrene-8-carboxylate |
| SMILES | COC(=O)c1cc2c(c3c(C)cccc13)-c1c(C)cccc1C(=O)/C2=C1\C(=O)c2cccc(C)c2-c2c1cc(C(=O)OC)c1cccc(C)c21 |
| InChI | InChI=1S/C44H32O6/c1-21-11-7-15-25-29(43(47)49-5)19-31-37(33(21)25)35-23(3)13-9-17-27(35)41(45)39(31)40-32-20-30(44(48)50-6)26-16-8-12-22(2)34(26)38(32)36-24(4)14-10-18-28(36)42(40)46/h7-20H,1-6H3/b40-39- |
| InChIKey | KMRZSBBFYNEWDF-MRNGAQBPSA-N |
| XLogP | 9.44 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.73 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|