C15H18N2O3 — CID 101178735
(8aS)-N-benzyl-1-oxo-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazine-4-carboxamide (PubChem CID 101178735) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is (8aS)-N-benzyl-1-oxo-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazine-4-carboxamide.
| Compound Name | (8aS)-N-benzyl-1-oxo-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazine-4-carboxamide |
|---|---|
| PubChem CID | 101178735 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (8aS)-N-benzyl-1-oxo-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1COC(=O)[C@@H]2CCCN12 |
| InChI | InChI=1S/C15H18N2O3/c18-14(16-9-11-5-2-1-3-6-11)13-10-20-15(19)12-7-4-8-17(12)13/h1-3,5-6,12-13H,4,7-10H2,(H,16,18)/t12-,13?/m0/s1 |
| InChIKey | KUSFKYJPWZPHQA-UEWDXFNNSA-N |
| XLogP | 0.69 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |