C56H60O6 — CID 101180055
bis[4-(4-heptoxyphenyl)phenyl] tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,11-dicarboxylate (PubChem CID 101180055) has the molecular formula C56H60O6 and a molecular weight of 829.09 g/mol. Its IUPAC name is bis[4-(4-heptoxyphenyl)phenyl] tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,11-dicarboxylate.
| Compound Name | bis[4-(4-heptoxyphenyl)phenyl] tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,11-dicarboxylate |
|---|---|
| PubChem CID | 101180055 |
| Molecular Formula | C56H60O6 |
| Molecular Weight | 829.09 g/mol |
| Exact Mass | 828.44 |
| IUPAC Name | bis[4-(4-heptoxyphenyl)phenyl] tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,11-dicarboxylate |
| SMILES | CCCCCCCOc1ccc(-c2ccc(OC(=O)c3cc4ccc3CCc3ccc(c(C(=O)Oc5ccc(-c6ccc(OCCCCCCC)cc6)cc5)c3)CC4)cc2)cc1 |
| InChI | InChI=1S/C56H60O6/c1-3-5-7-9-11-37-59-49-29-21-43(22-30-49)45-25-33-51(34-26-45)61-55(57)53-39-41-13-17-47(53)19-15-42-14-18-48(20-16-41)54(40-42)56(58)62-52-35-27-46(28-36-52)44-23-31-50(32-24-44)60-38-12-10-8-6-4-2/h13-14,17-18,21-36,39-40H,3-12,15-16,19-20,37-38H2,1-2H3 |
| InChIKey | BGIXEZPHSGBYOH-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.09 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|