C22H39NO4 — CID 101180257
tert-butyl (4S)-4-[(1R)-1-hydroxy-2,2-dimethyldec-3-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 101180257) has the molecular formula C22H39NO4 and a molecular weight of 381.56 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(1R)-1-hydroxy-2,2-dimethyldec-3-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(1R)-1-hydroxy-2,2-dimethyldec-3-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 101180257 |
| Molecular Formula | C22H39NO4 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.29 |
| IUPAC Name | tert-butyl (4S)-4-[(1R)-1-hydroxy-2,2-dimethyldec-3-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCCCCC#CC(C)(C)[C@@H](O)[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H39NO4/c1-9-10-11-12-13-14-15-21(5,6)18(24)17-16-26-22(7,8)23(17)19(25)27-20(2,3)4/h17-18,24H,9-13,16H2,1-8H3/t17-,18-/m0/s1 |
| InChIKey | ICJMGEJFVCWSJW-ROUUACIJSA-N |
| XLogP | 4.72 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|