C29H45NO3 — CID 101045366
tert-butyl (4R)-2,2-dimethyl-4-[2-(4-undec-1-ynylphenyl)ethyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 101045366) has the molecular formula C29H45NO3 and a molecular weight of 455.68 g/mol. Its IUPAC name is tert-butyl (4R)-2,2-dimethyl-4-[2-(4-undec-1-ynylphenyl)ethyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2,2-dimethyl-4-[2-(4-undec-1-ynylphenyl)ethyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 101045366 |
| Molecular Formula | C29H45NO3 |
| Molecular Weight | 455.68 g/mol |
| Exact Mass | 455.34 |
| IUPAC Name | tert-butyl (4R)-2,2-dimethyl-4-[2-(4-undec-1-ynylphenyl)ethyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCCCCCCCC#Cc1ccc(CC[C@@H]2COC(C)(C)N2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H45NO3/c1-7-8-9-10-11-12-13-14-15-16-24-17-19-25(20-18-24)21-22-26-23-32-29(5,6)30(26)27(31)33-28(2,3)4/h17-20,26H,7-14,21-23H2,1-6H3/t26-/m1/s1 |
| InChIKey | AGHWYCXJHYVKJC-AREMUKBSSA-N |
| XLogP | 7.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.68 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|