About S-(4-hept-1-ynylphenyl) 4-heptylbenzenecarbothioate
S-(4-hept-1-ynylphenyl) 4-heptylbenzenecarbothioate (PubChem CID 102208817) has the molecular formula C27H34OS
and a molecular weight of 406.64 g/mol. Its IUPAC name is S-(4-hept-1-ynylphenyl) 4-heptylbenzenecarbothioate.
Molecular Properties
| Compound Name | S-(4-hept-1-ynylphenyl) 4-heptylbenzenecarbothioate |
| PubChem CID | 102208817 |
| Molecular Formula | C27H34OS |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | S-(4-hept-1-ynylphenyl) 4-heptylbenzenecarbothioate |
| SMILES | CCCCCC#Cc1ccc(SC(=O)c2ccc(CCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C27H34OS/c1-3-5-7-9-11-13-23-15-19-25(20-16-23)27(28)29-26-21-17-24(18-22-26)14-12-10-8-6-4-2/h15-22H,3-11,13H2,1-2H3 |
| InChIKey | KEQGPVBFEDDCDA-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze S-(4-hept-1-ynylphenyl) 4-heptylbenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-hept-1-ynylphenyl) 4-heptylbenzenecarbothioate?
The IUPAC name of S-(4-hept-1-ynylphenyl) 4-heptylbenzenecarbothioate (CID 102208817) is S-(4-hept-1-ynylphenyl) 4-heptylbenzenecarbothioate.
What is the SMILES notation for S-(4-hept-1-ynylphenyl) 4-heptylbenzenecarbothioate?
The canonical SMILES for S-(4-hept-1-ynylphenyl) 4-heptylbenzenecarbothioate is CCCCCC#Cc1ccc(SC(=O)c2ccc(CCCCCCC)cc2)cc1.
What is the InChIKey of S-(4-hept-1-ynylphenyl) 4-heptylbenzenecarbothioate?
The InChIKey is KEQGPVBFEDDCDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H34OS/c1-3-5-7-9-11-13-23-15-19-25(20-16-23)27(28)29-26-21-17-24(18-22-26)14-12-10-8-6-4-2/h15-22H,3-11,13H2,1-2H3.
What are the key properties of S-(4-hept-1-ynylphenyl) 4-heptylbenzenecarbothioate?
S-(4-hept-1-ynylphenyl) 4-heptylbenzenecarbothioate has a molecular weight of 406.64 g/mol, XLogP of 8.06, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-hept-1-ynylphenyl) 4-heptylbenzenecarbothioate is sourced from PubChem (CID 102208817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).