C13H23I — CID 101180288
1,2-diethyl-1-[(Z)-4-iodohex-3-en-3-yl]cyclopropane (PubChem CID 101180288) has the molecular formula C13H23I and a molecular weight of 306.23 g/mol. Its IUPAC name is 1,2-diethyl-1-[(Z)-4-iodohex-3-en-3-yl]cyclopropane.
| Compound Name | 1,2-diethyl-1-[(Z)-4-iodohex-3-en-3-yl]cyclopropane |
|---|---|
| PubChem CID | 101180288 |
| Molecular Formula | C13H23I |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 1,2-diethyl-1-[(Z)-4-iodohex-3-en-3-yl]cyclopropane |
| SMILES | CC/C(I)=C(\CC)C1(CC)CC1CC |
| InChI | InChI=1S/C13H23I/c1-5-10-9-13(10,8-4)11(6-2)12(14)7-3/h10H,5-9H2,1-4H3/b12-11- |
| InChIKey | GWPMVXCZGOBVJN-QXMHVHEDSA-N |
| XLogP | 5.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|