C12H12N2O2 — CID 101181572
(5Z)-5-[(4-hydroxyphenyl)methylidene]-2,3-dimethyl(213C)imidazol-4-one (PubChem CID 101181572) has the molecular formula C12H12N2O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is (5Z)-5-[(4-hydroxyphenyl)methylidene]-2,3-dimethyl(213C)imidazol-4-one.
| Compound Name | (5Z)-5-[(4-hydroxyphenyl)methylidene]-2,3-dimethyl(213C)imidazol-4-one |
|---|---|
| PubChem CID | 101181572 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | (5Z)-5-[(4-hydroxyphenyl)methylidene]-2,3-dimethyl(213C)imidazol-4-one |
| SMILES | C[13C]1=N/C(=C\c2ccc(O)cc2)C(=O)N1C |
| InChI | InChI=1S/C12H12N2O2/c1-8-13-11(12(16)14(8)2)7-9-3-5-10(15)6-4-9/h3-7,15H,1-2H3/b11-7-/i8+1 |
| InChIKey | GOZZJYVTRWULOT-SRHTZDEWSA-N |
| XLogP | 1.62 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|