C8H16O3S — CID 101181651
[(3R,4R)-4-(methoxymethoxy)thian-3-yl]methanol (PubChem CID 101181651) has the molecular formula C8H16O3S and a molecular weight of 192.28 g/mol. Its IUPAC name is [(3R,4R)-4-(methoxymethoxy)thian-3-yl]methanol.
| Compound Name | [(3R,4R)-4-(methoxymethoxy)thian-3-yl]methanol |
|---|---|
| PubChem CID | 101181651 |
| Molecular Formula | C8H16O3S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | [(3R,4R)-4-(methoxymethoxy)thian-3-yl]methanol |
| SMILES | COCO[C@@H]1CCSC[C@@H]1CO |
| InChI | InChI=1S/C8H16O3S/c1-10-6-11-8-2-3-12-5-7(8)4-9/h7-9H,2-6H2,1H3/t7-,8+/m0/s1 |
| InChIKey | DHJDTXUVXPTZEO-JGVFFNPUSA-N |
| XLogP | 0.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|