C22H20O4S — CID 101182831
[(2R,3S)-2-phenyl-2,3-dihydro-1-benzofuran-3-yl]methyl 4-methylbenzenesulfonate (PubChem CID 101182831) has the molecular formula C22H20O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is [(2R,3S)-2-phenyl-2,3-dihydro-1-benzofuran-3-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S)-2-phenyl-2,3-dihydro-1-benzofuran-3-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101182831 |
| Molecular Formula | C22H20O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | [(2R,3S)-2-phenyl-2,3-dihydro-1-benzofuran-3-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2c3ccccc3O[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20O4S/c1-16-11-13-18(14-12-16)27(23,24)25-15-20-19-9-5-6-10-21(19)26-22(20)17-7-3-2-4-8-17/h2-14,20,22H,15H2,1H3/t20-,22+/m1/s1 |
| InChIKey | WJCRFTTXOUCCAH-IRLDBZIGSA-N |
| XLogP | 4.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|