C23H17BrF6N2 — CID 101183593
1-bromo-4-[[4-tert-butyl-2,6-bis(trifluoromethyl)phenyl]-diazomethyl]naphthalene (PubChem CID 101183593) has the molecular formula C23H17BrF6N2 and a molecular weight of 515.30 g/mol. Its IUPAC name is 1-bromo-4-[[4-tert-butyl-2,6-bis(trifluoromethyl)phenyl]-diazomethyl]naphthalene.
| Compound Name | 1-bromo-4-[[4-tert-butyl-2,6-bis(trifluoromethyl)phenyl]-diazomethyl]naphthalene |
|---|---|
| PubChem CID | 101183593 |
| Molecular Formula | C23H17BrF6N2 |
| Molecular Weight | 515.30 g/mol |
| Exact Mass | 514.05 |
| IUPAC Name | 1-bromo-4-[[4-tert-butyl-2,6-bis(trifluoromethyl)phenyl]-diazomethyl]naphthalene |
| SMILES | CC(C)(C)c1cc(C(F)(F)F)c(C(=[N+]=[N-])c2ccc(Br)c3ccccc23)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H17BrF6N2/c1-21(2,3)12-10-16(22(25,26)27)19(17(11-12)23(28,29)30)20(32-31)15-8-9-18(24)14-7-5-4-6-13(14)15/h4-11H,1-3H3 |
| InChIKey | YCZHOJUMMJFNLD-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.30 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|