C27H14Br2F6N2 — CID 86096908
1-bromo-2-[[2-bromo-4-phenyl-6-(trifluoromethyl)phenyl]-diazomethyl]-5-phenyl-3-(trifluoromethyl)benzene (PubChem CID 86096908) has the molecular formula C27H14Br2F6N2 and a molecular weight of 640.22 g/mol. Its IUPAC name is 1-bromo-2-[[2-bromo-4-phenyl-6-(trifluoromethyl)phenyl]-diazomethyl]-5-phenyl-3-(trifluoromethyl)benzene.
| Compound Name | 1-bromo-2-[[2-bromo-4-phenyl-6-(trifluoromethyl)phenyl]-diazomethyl]-5-phenyl-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 86096908 |
| Molecular Formula | C27H14Br2F6N2 |
| Molecular Weight | 640.22 g/mol |
| Exact Mass | 637.94 |
| IUPAC Name | 1-bromo-2-[[2-bromo-4-phenyl-6-(trifluoromethyl)phenyl]-diazomethyl]-5-phenyl-3-(trifluoromethyl)benzene |
| SMILES | [N-]=[N+]=C(c1c(Br)cc(-c2ccccc2)cc1C(F)(F)F)c1c(Br)cc(-c2ccccc2)cc1C(F)(F)F |
| InChI | InChI=1S/C27H14Br2F6N2/c28-21-13-17(15-7-3-1-4-8-15)11-19(26(30,31)32)23(21)25(37-36)24-20(27(33,34)35)12-18(14-22(24)29)16-9-5-2-6-10-16/h1-14H |
| InChIKey | GUXMYWZRSUMPSS-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.22 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|