C27H20Br2N2 — CID 101225483
1,3-dibromo-2-[diazo-(2,6-dimethyl-4-phenylphenyl)methyl]-5-phenylbenzene (PubChem CID 101225483) has the molecular formula C27H20Br2N2 and a molecular weight of 532.28 g/mol. Its IUPAC name is 1,3-dibromo-2-[diazo-(2,6-dimethyl-4-phenylphenyl)methyl]-5-phenylbenzene.
| Compound Name | 1,3-dibromo-2-[diazo-(2,6-dimethyl-4-phenylphenyl)methyl]-5-phenylbenzene |
|---|---|
| PubChem CID | 101225483 |
| Molecular Formula | C27H20Br2N2 |
| Molecular Weight | 532.28 g/mol |
| Exact Mass | 530.00 |
| IUPAC Name | 1,3-dibromo-2-[diazo-(2,6-dimethyl-4-phenylphenyl)methyl]-5-phenylbenzene |
| SMILES | Cc1cc(-c2ccccc2)cc(C)c1C(=[N+]=[N-])c1c(Br)cc(-c2ccccc2)cc1Br |
| InChI | InChI=1S/C27H20Br2N2/c1-17-13-21(19-9-5-3-6-10-19)14-18(2)25(17)27(31-30)26-23(28)15-22(16-24(26)29)20-11-7-4-8-12-20/h3-16H,1-2H3 |
| InChIKey | HEMDXIXGSZEKKR-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.28 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|