C23H22Br2F6N2 — CID 101183679
1-bromo-2-[[2-bromo-4-tert-butyl-6-(trifluoromethyl)phenyl]-diazomethyl]-5-tert-butyl-3-(trifluoromethyl)benzene (PubChem CID 101183679) has the molecular formula C23H22Br2F6N2 and a molecular weight of 600.24 g/mol. Its IUPAC name is 1-bromo-2-[[2-bromo-4-tert-butyl-6-(trifluoromethyl)phenyl]-diazomethyl]-5-tert-butyl-3-(trifluoromethyl)benzene.
| Compound Name | 1-bromo-2-[[2-bromo-4-tert-butyl-6-(trifluoromethyl)phenyl]-diazomethyl]-5-tert-butyl-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 101183679 |
| Molecular Formula | C23H22Br2F6N2 |
| Molecular Weight | 600.24 g/mol |
| Exact Mass | 598.01 |
| IUPAC Name | 1-bromo-2-[[2-bromo-4-tert-butyl-6-(trifluoromethyl)phenyl]-diazomethyl]-5-tert-butyl-3-(trifluoromethyl)benzene |
| SMILES | CC(C)(C)c1cc(Br)c(C(=[N+]=[N-])c2c(Br)cc(C(C)(C)C)cc2C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H22Br2F6N2/c1-20(2,3)11-7-13(22(26,27)28)17(15(24)9-11)19(33-32)18-14(23(29,30)31)8-12(10-16(18)25)21(4,5)6/h7-10H,1-6H3 |
| InChIKey | PMHROJHLWYFYOY-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.24 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|