C19H19Br3N2 — CID 11752642
1,3,5-tribromo-2-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]benzene (PubChem CID 11752642) has the molecular formula C19H19Br3N2 and a molecular weight of 515.09 g/mol. Its IUPAC name is 1,3,5-tribromo-2-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]benzene.
| Compound Name | 1,3,5-tribromo-2-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]benzene |
|---|---|
| PubChem CID | 11752642 |
| Molecular Formula | C19H19Br3N2 |
| Molecular Weight | 515.09 g/mol |
| Exact Mass | 511.91 |
| IUPAC Name | 1,3,5-tribromo-2-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]benzene |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1C(=[N+]=[N-])c1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C19H19Br3N2/c1-10-6-12(19(3,4)5)7-11(2)16(10)18(24-23)17-14(21)8-13(20)9-15(17)22/h6-9H,1-5H3 |
| InChIKey | FPWXFTNDYHDWNJ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.09 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|