C22H21Br2F6N — CID 100996747
(2,6-dibromo-4-tert-butylphenyl)-[4-propan-2-yl-2,6-bis(trifluoromethyl)phenyl]methanimine (PubChem CID 100996747) has the molecular formula C22H21Br2F6N and a molecular weight of 573.21 g/mol. Its IUPAC name is (2,6-dibromo-4-tert-butylphenyl)-[4-propan-2-yl-2,6-bis(trifluoromethyl)phenyl]methanimine.
| Compound Name | (2,6-dibromo-4-tert-butylphenyl)-[4-propan-2-yl-2,6-bis(trifluoromethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 100996747 |
| Molecular Formula | C22H21Br2F6N |
| Molecular Weight | 573.21 g/mol |
| Exact Mass | 570.99 |
| IUPAC Name | (2,6-dibromo-4-tert-butylphenyl)-[4-propan-2-yl-2,6-bis(trifluoromethyl)phenyl]methanimine |
| SMILES | [H]/N=C(\c1c(Br)cc(C(C)(C)C)cc1Br)c1c(C(F)(F)F)cc(C(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C22H21Br2F6N/c1-10(2)11-6-13(21(25,26)27)17(14(7-11)22(28,29)30)19(31)18-15(23)8-12(9-16(18)24)20(3,4)5/h6-10,31H,1-5H3/b31-19- |
| InChIKey | UWJHILHMWBVVNF-DXJNIWACSA-N |
| XLogP | 9.09 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.21 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|