C16H15Br2N — CID 11682385
(4-bromophenyl)-(3-bromo-2,4,6-trimethylphenyl)methanimine (PubChem CID 11682385) has the molecular formula C16H15Br2N and a molecular weight of 381.11 g/mol. Its IUPAC name is (4-bromophenyl)-(3-bromo-2,4,6-trimethylphenyl)methanimine.
| Compound Name | (4-bromophenyl)-(3-bromo-2,4,6-trimethylphenyl)methanimine |
|---|---|
| PubChem CID | 11682385 |
| Molecular Formula | C16H15Br2N |
| Molecular Weight | 381.11 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | (4-bromophenyl)-(3-bromo-2,4,6-trimethylphenyl)methanimine |
| SMILES | [H]/N=C(\c1ccc(Br)cc1)c1c(C)cc(C)c(Br)c1C |
| InChI | InChI=1S/C16H15Br2N/c1-9-8-10(2)15(18)11(3)14(9)16(19)12-4-6-13(17)7-5-12/h4-8,19H,1-3H3/b19-16+ |
| InChIKey | FKVJPSZTFHEGCV-KNTRCKAVSA-N |
| XLogP | 5.55 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.11 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|