C16H16BrN — CID 11565694
(2-bromophenyl)-(2,4,6-trimethylphenyl)methanimine (PubChem CID 11565694) has the molecular formula C16H16BrN and a molecular weight of 302.21 g/mol. Its IUPAC name is (2-bromophenyl)-(2,4,6-trimethylphenyl)methanimine.
| Compound Name | (2-bromophenyl)-(2,4,6-trimethylphenyl)methanimine |
|---|---|
| PubChem CID | 11565694 |
| Molecular Formula | C16H16BrN |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | (2-bromophenyl)-(2,4,6-trimethylphenyl)methanimine |
| SMILES | [H]/N=C(\c1ccccc1Br)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C16H16BrN/c1-10-8-11(2)15(12(3)9-10)16(18)13-6-4-5-7-14(13)17/h4-9,18H,1-3H3/b18-16+ |
| InChIKey | UEXXOLWEQHBXAJ-FBMGVBCBSA-N |
| XLogP | 4.79 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|