C15H15N — CID 165339834
(2,5-dimethylphenyl)-phenylmethanimine (PubChem CID 165339834) has the molecular formula C15H15N and a molecular weight of 209.29 g/mol. Its IUPAC name is (2,5-dimethylphenyl)-phenylmethanimine.
| Compound Name | (2,5-dimethylphenyl)-phenylmethanimine |
|---|---|
| PubChem CID | 165339834 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (2,5-dimethylphenyl)-phenylmethanimine |
| SMILES | [H]/N=C(\c1ccccc1)c1cc(C)ccc1C |
| InChI | InChI=1S/C15H15N/c1-11-8-9-12(2)14(10-11)15(16)13-6-4-3-5-7-13/h3-10,16H,1-2H3/b16-15+ |
| InChIKey | OGWHLATUKVEFKQ-FOCLMDBBSA-N |
| XLogP | 3.72 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|