C24H28Br2N2Si — CID 11261107
2-[3,5-dibromo-4-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]phenyl]ethynyl-trimethylsilane (PubChem CID 11261107) has the molecular formula C24H28Br2N2Si and a molecular weight of 532.40 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]phenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[3,5-dibromo-4-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]phenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 11261107 |
| Molecular Formula | C24H28Br2N2Si |
| Molecular Weight | 532.40 g/mol |
| Exact Mass | 530.04 |
| IUPAC Name | 2-[3,5-dibromo-4-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]phenyl]ethynyl-trimethylsilane |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1C(=[N+]=[N-])c1c(Br)cc(C#C[Si](C)(C)C)cc1Br |
| InChI | InChI=1S/C24H28Br2N2Si/c1-15-11-18(24(3,4)5)12-16(2)21(15)23(28-27)22-19(25)13-17(14-20(22)26)9-10-29(6,7)8/h11-14H,1-8H3 |
| InChIKey | JYBBQYDZUTWVCW-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.40 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|