C29H37BrN2Si2 — CID 11226618
2-[3-bromo-2-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]-5-(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane (PubChem CID 11226618) has the molecular formula C29H37BrN2Si2 and a molecular weight of 549.71 g/mol. Its IUPAC name is 2-[3-bromo-2-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]-5-(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[3-bromo-2-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]-5-(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 11226618 |
| Molecular Formula | C29H37BrN2Si2 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | 2-[3-bromo-2-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]-5-(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1C(=[N+]=[N-])c1c(Br)cc(C#C[Si](C)(C)C)cc1C#C[Si](C)(C)C |
| InChI | InChI=1S/C29H37BrN2Si2/c1-20-16-24(29(3,4)5)17-21(2)26(20)28(32-31)27-23(13-15-34(9,10)11)18-22(19-25(27)30)12-14-33(6,7)8/h16-19H,1-11H3 |
| InChIKey | JNEBWLGEHFDXMG-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|