C34H46N2Si3 — CID 11433026
2-[2-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]-3,5-bis(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane (PubChem CID 11433026) has the molecular formula C34H46N2Si3 and a molecular weight of 567.01 g/mol. Its IUPAC name is 2-[2-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]-3,5-bis(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[2-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]-3,5-bis(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 11433026 |
| Molecular Formula | C34H46N2Si3 |
| Molecular Weight | 567.01 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | 2-[2-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]-3,5-bis(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1C(=[N+]=[N-])c1c(C#C[Si](C)(C)C)cc(C#C[Si](C)(C)C)cc1C#C[Si](C)(C)C |
| InChI | InChI=1S/C34H46N2Si3/c1-25-21-30(34(3,4)5)22-26(2)31(25)33(36-35)32-28(16-19-38(9,10)11)23-27(15-18-37(6,7)8)24-29(32)17-20-39(12,13)14/h21-24H,1-14H3 |
| InChIKey | WNROGUZSYYVWRQ-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.01 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|