C20H24N2 — CID 11471887
1-tert-butyl-2-[diazo(phenyl)methyl]-3,4,5-trimethylbenzene (PubChem CID 11471887) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 1-tert-butyl-2-[diazo(phenyl)methyl]-3,4,5-trimethylbenzene.
| Compound Name | 1-tert-butyl-2-[diazo(phenyl)methyl]-3,4,5-trimethylbenzene |
|---|---|
| PubChem CID | 11471887 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 1-tert-butyl-2-[diazo(phenyl)methyl]-3,4,5-trimethylbenzene |
| SMILES | Cc1cc(C(C)(C)C)c(C(=[N+]=[N-])c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C20H24N2/c1-13-12-17(20(4,5)6)18(15(3)14(13)2)19(22-21)16-10-8-7-9-11-16/h7-12H,1-6H3 |
| InChIKey | FMMOOLMZWRSNBS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|