C29H39BrSi2 — CID 23231141
2-[3-bromo-2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-5-(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane (PubChem CID 23231141) has the molecular formula C29H39BrSi2 and a molecular weight of 523.71 g/mol. Its IUPAC name is 2-[3-bromo-2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-5-(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[3-bromo-2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-5-(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 23231141 |
| Molecular Formula | C29H39BrSi2 |
| Molecular Weight | 523.71 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 2-[3-bromo-2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-5-(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1Cc1c(Br)cc(C#C[Si](C)(C)C)cc1C#C[Si](C)(C)C |
| InChI | InChI=1S/C29H39BrSi2/c1-21-16-25(29(3,4)5)17-22(2)26(21)20-27-24(13-15-32(9,10)11)18-23(19-28(27)30)12-14-31(6,7)8/h16-19H,20H2,1-11H3 |
| InChIKey | KBIWNRZOVNMJRV-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.71 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|