About [4-(4-bromo-2,5-dimethylphenyl)phenyl]-trimethylsilane
[4-(4-bromo-2,5-dimethylphenyl)phenyl]-trimethylsilane (PubChem CID 86085130) has the molecular formula C17H21BrSi
and a molecular weight of 333.35 g/mol. Its IUPAC name is [4-(4-bromo-2,5-dimethylphenyl)phenyl]-trimethylsilane.
Molecular Properties
| Compound Name | [4-(4-bromo-2,5-dimethylphenyl)phenyl]-trimethylsilane |
| PubChem CID | 86085130 |
| Molecular Formula | C17H21BrSi |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | [4-(4-bromo-2,5-dimethylphenyl)phenyl]-trimethylsilane |
| SMILES | Cc1cc(-c2ccc([Si](C)(C)C)cc2)c(C)cc1Br |
| InChI | InChI=1S/C17H21BrSi/c1-12-11-17(18)13(2)10-16(12)14-6-8-15(9-7-14)19(3,4)5/h6-11H,1-5H3 |
| InChIKey | RVDYULXOCMXJQB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-bromo-2,5-dimethylphenyl)phenyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-bromo-2,5-dimethylphenyl)phenyl]-trimethylsilane?
The IUPAC name of [4-(4-bromo-2,5-dimethylphenyl)phenyl]-trimethylsilane (CID 86085130) is [4-(4-bromo-2,5-dimethylphenyl)phenyl]-trimethylsilane.
What is the SMILES notation for [4-(4-bromo-2,5-dimethylphenyl)phenyl]-trimethylsilane?
The canonical SMILES for [4-(4-bromo-2,5-dimethylphenyl)phenyl]-trimethylsilane is Cc1cc(-c2ccc([Si](C)(C)C)cc2)c(C)cc1Br.
What is the InChIKey of [4-(4-bromo-2,5-dimethylphenyl)phenyl]-trimethylsilane?
The InChIKey is RVDYULXOCMXJQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21BrSi/c1-12-11-17(18)13(2)10-16(12)14-6-8-15(9-7-14)19(3,4)5/h6-11H,1-5H3.
What are the key properties of [4-(4-bromo-2,5-dimethylphenyl)phenyl]-trimethylsilane?
[4-(4-bromo-2,5-dimethylphenyl)phenyl]-trimethylsilane has a molecular weight of 333.35 g/mol, XLogP of 5.28, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-bromo-2,5-dimethylphenyl)phenyl]-trimethylsilane is sourced from PubChem (CID 86085130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).