C21H20Br2I2N2Si — CID 101476189
2-[3,5-dibromo-4-[diazo-(3,5-diiodo-2,4,6-trimethylphenyl)methyl]phenyl]ethynyl-trimethylsilane (PubChem CID 101476189) has the molecular formula C21H20Br2I2N2Si and a molecular weight of 742.11 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-[diazo-(3,5-diiodo-2,4,6-trimethylphenyl)methyl]phenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[3,5-dibromo-4-[diazo-(3,5-diiodo-2,4,6-trimethylphenyl)methyl]phenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 101476189 |
| Molecular Formula | C21H20Br2I2N2Si |
| Molecular Weight | 742.11 g/mol |
| Exact Mass | 739.79 |
| IUPAC Name | 2-[3,5-dibromo-4-[diazo-(3,5-diiodo-2,4,6-trimethylphenyl)methyl]phenyl]ethynyl-trimethylsilane |
| SMILES | Cc1c(I)c(C)c(C(=[N+]=[N-])c2c(Br)cc(C#C[Si](C)(C)C)cc2Br)c(C)c1I |
| InChI | InChI=1S/C21H20Br2I2N2Si/c1-11-17(12(2)20(25)13(3)19(11)24)21(27-26)18-15(22)9-14(10-16(18)23)7-8-28(4,5)6/h9-10H,1-6H3 |
| InChIKey | ZFZQKAHBMWOBCH-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.11 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|