C18H12Br4N2 — CID 102044117
1,3-dibromo-5-[diazo-(2,6-dibromo-3-ethynylphenyl)methyl]-2,4,6-trimethylbenzene (PubChem CID 102044117) has the molecular formula C18H12Br4N2 and a molecular weight of 575.92 g/mol. Its IUPAC name is 1,3-dibromo-5-[diazo-(2,6-dibromo-3-ethynylphenyl)methyl]-2,4,6-trimethylbenzene.
| Compound Name | 1,3-dibromo-5-[diazo-(2,6-dibromo-3-ethynylphenyl)methyl]-2,4,6-trimethylbenzene |
|---|---|
| PubChem CID | 102044117 |
| Molecular Formula | C18H12Br4N2 |
| Molecular Weight | 575.92 g/mol |
| Exact Mass | 571.77 |
| IUPAC Name | 1,3-dibromo-5-[diazo-(2,6-dibromo-3-ethynylphenyl)methyl]-2,4,6-trimethylbenzene |
| SMILES | C#Cc1ccc(Br)c(C(=[N+]=[N-])c2c(C)c(Br)c(C)c(Br)c2C)c1Br |
| InChI | InChI=1S/C18H12Br4N2/c1-5-11-6-7-12(19)14(17(11)22)18(24-23)13-8(2)15(20)10(4)16(21)9(13)3/h1,6-7H,2-4H3 |
| InChIKey | YKRQHIQRAZRVSY-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.92 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|