C17H13Br5N2 — CID 101245421
1,3,5-tribromo-2-[diazo-(2,6-dibromo-4-tert-butylphenyl)methyl]benzene (PubChem CID 101245421) has the molecular formula C17H13Br5N2 and a molecular weight of 644.82 g/mol. Its IUPAC name is 1,3,5-tribromo-2-[diazo-(2,6-dibromo-4-tert-butylphenyl)methyl]benzene.
| Compound Name | 1,3,5-tribromo-2-[diazo-(2,6-dibromo-4-tert-butylphenyl)methyl]benzene |
|---|---|
| PubChem CID | 101245421 |
| Molecular Formula | C17H13Br5N2 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 639.70 |
| IUPAC Name | 1,3,5-tribromo-2-[diazo-(2,6-dibromo-4-tert-butylphenyl)methyl]benzene |
| SMILES | CC(C)(C)c1cc(Br)c(C(=[N+]=[N-])c2c(Br)cc(Br)cc2Br)c(Br)c1 |
| InChI | InChI=1S/C17H13Br5N2/c1-17(2,3)8-4-10(19)14(11(20)5-8)16(24-23)15-12(21)6-9(18)7-13(15)22/h4-7H,1-3H3 |
| InChIKey | SOMUJQZFXZNJGI-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|