C13H4Br6N2 — CID 71350445
1,3,5-tribromo-2-[diazo-(2,4,6-tribromophenyl)methyl]benzene (PubChem CID 71350445) has the molecular formula C13H4Br6N2 and a molecular weight of 667.61 g/mol. Its IUPAC name is 1,3,5-tribromo-2-[diazo-(2,4,6-tribromophenyl)methyl]benzene.
| Compound Name | 1,3,5-tribromo-2-[diazo-(2,4,6-tribromophenyl)methyl]benzene |
|---|---|
| PubChem CID | 71350445 |
| Molecular Formula | C13H4Br6N2 |
| Molecular Weight | 667.61 g/mol |
| Exact Mass | 661.55 |
| IUPAC Name | 1,3,5-tribromo-2-[diazo-(2,4,6-tribromophenyl)methyl]benzene |
| SMILES | [N-]=[N+]=C(c1c(Br)cc(Br)cc1Br)c1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C13H4Br6N2/c14-5-1-7(16)11(8(17)2-5)13(21-20)12-9(18)3-6(15)4-10(12)19/h1-4H |
| InChIKey | PUVJTCFSDMDWJL-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.61 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|