C20H17Br3I2N2Si — CID 102300875
2-[3,5-dibromo-4-[(2-bromo-3,5-diiodo-4,6-dimethylphenyl)-diazomethyl]phenyl]ethynyl-trimethylsilane (PubChem CID 102300875) has the molecular formula C20H17Br3I2N2Si and a molecular weight of 806.98 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-[(2-bromo-3,5-diiodo-4,6-dimethylphenyl)-diazomethyl]phenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[3,5-dibromo-4-[(2-bromo-3,5-diiodo-4,6-dimethylphenyl)-diazomethyl]phenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 102300875 |
| Molecular Formula | C20H17Br3I2N2Si |
| Molecular Weight | 806.98 g/mol |
| Exact Mass | 803.68 |
| IUPAC Name | 2-[3,5-dibromo-4-[(2-bromo-3,5-diiodo-4,6-dimethylphenyl)-diazomethyl]phenyl]ethynyl-trimethylsilane |
| SMILES | Cc1c(I)c(C)c(C(=[N+]=[N-])c2c(Br)cc(C#C[Si](C)(C)C)cc2Br)c(Br)c1I |
| InChI | InChI=1S/C20H17Br3I2N2Si/c1-10-15(17(23)19(25)11(2)18(10)24)20(27-26)16-13(21)8-12(9-14(16)22)6-7-28(3,4)5/h8-9H,1-5H3 |
| InChIKey | NRFDRINUYONFAC-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.98 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|