C53H50Br4N4Si — CID 11457486
2-[3,5-bis[2-[3,5-dibromo-4-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]phenyl]ethynyl]phenyl]ethynyl-trimethylsilane (PubChem CID 11457486) has the molecular formula C53H50Br4N4Si and a molecular weight of 1090.71 g/mol. Its IUPAC name is 2-[3,5-bis[2-[3,5-dibromo-4-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]phenyl]ethynyl]phenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[3,5-bis[2-[3,5-dibromo-4-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]phenyl]ethynyl]phenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 11457486 |
| Molecular Formula | C53H50Br4N4Si |
| Molecular Weight | 1090.71 g/mol |
| Exact Mass | 1086.05 |
| IUPAC Name | 2-[3,5-bis[2-[3,5-dibromo-4-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]phenyl]ethynyl]phenyl]ethynyl-trimethylsilane |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1C(=[N+]=[N-])c1c(Br)cc(C#Cc2cc(C#Cc3cc(Br)c(C(=[N+]=[N-])c4c(C)cc(C(C)(C)C)cc4C)c(Br)c3)cc(C#C[Si](C)(C)C)c2)cc1Br |
| InChI | InChI=1S/C53H50Br4N4Si/c1-31-20-40(52(5,6)7)21-32(2)46(31)50(60-58)48-42(54)27-37(28-43(48)55)16-14-35-24-36(26-39(25-35)18-19-62(11,12)13)15-17-38-29-44(56)49(45(57)30-38)51(61-59)47-33(3)22-41(23-34(47)4)53(8,9)10/h20-30H,1-13H3 |
| InChIKey | ACSQLPNSNJCJJK-UHFFFAOYSA-N |
| XLogP | 14.73 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1090.71 |
| LogP ≤ 5 | 14.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|