C48H56Br4Si2 — CID 11240132
2-[4-[(E)-1,2-bis(4-tert-butyl-2,6-dimethylphenyl)-2-[2,6-dibromo-4-(2-trimethylsilylethynyl)phenyl]ethenyl]-3,5-dibromophenyl]ethynyl-trimethylsilane (PubChem CID 11240132) has the molecular formula C48H56Br4Si2 and a molecular weight of 1008.76 g/mol. Its IUPAC name is 2-[4-[(E)-1,2-bis(4-tert-butyl-2,6-dimethylphenyl)-2-[2,6-dibromo-4-(2-trimethylsilylethynyl)phenyl]ethenyl]-3,5-dibromophenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[4-[(E)-1,2-bis(4-tert-butyl-2,6-dimethylphenyl)-2-[2,6-dibromo-4-(2-trimethylsilylethynyl)phenyl]ethenyl]-3,5-dibromophenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 11240132 |
| Molecular Formula | C48H56Br4Si2 |
| Molecular Weight | 1008.76 g/mol |
| Exact Mass | 1004.07 |
| IUPAC Name | 2-[4-[(E)-1,2-bis(4-tert-butyl-2,6-dimethylphenyl)-2-[2,6-dibromo-4-(2-trimethylsilylethynyl)phenyl]ethenyl]-3,5-dibromophenyl]ethynyl-trimethylsilane |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1/C(=C(/c1c(C)cc(C(C)(C)C)cc1C)c1c(Br)cc(C#C[Si](C)(C)C)cc1Br)c1c(Br)cc(C#C[Si](C)(C)C)cc1Br |
| InChI | InChI=1S/C48H56Br4Si2/c1-29-21-35(47(5,6)7)22-30(2)41(29)45(43-37(49)25-33(26-38(43)50)17-19-53(11,12)13)46(42-31(3)23-36(24-32(42)4)48(8,9)10)44-39(51)27-34(28-40(44)52)18-20-54(14,15)16/h21-28H,1-16H3/b46-45+ |
| InChIKey | HEPNDWLMZFNLKL-XVIFHXHVSA-N |
| XLogP | 16.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1008.76 |
| LogP ≤ 5 | 16.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|