C40H50Br2Si2 — CID 134953997
2-[2,3-dibromo-12-[2-tri(propan-2-yl)silylethynyl]tetracen-5-yl]ethynyl-tri(propan-2-yl)silane (PubChem CID 134953997) has the molecular formula C40H50Br2Si2 and a molecular weight of 746.82 g/mol. Its IUPAC name is 2-[2,3-dibromo-12-[2-tri(propan-2-yl)silylethynyl]tetracen-5-yl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[2,3-dibromo-12-[2-tri(propan-2-yl)silylethynyl]tetracen-5-yl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134953997 |
| Molecular Formula | C40H50Br2Si2 |
| Molecular Weight | 746.82 g/mol |
| Exact Mass | 744.18 |
| IUPAC Name | 2-[2,3-dibromo-12-[2-tri(propan-2-yl)silylethynyl]tetracen-5-yl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#Cc1c2cc(Br)c(Br)cc2c(C#C[Si](C(C)C)(C(C)C)C(C)C)c2cc3ccccc3cc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C40H50Br2Si2/c1-25(2)43(26(3)4,27(5)6)19-17-33-35-21-31-15-13-14-16-32(31)22-36(35)34(38-24-40(42)39(41)23-37(33)38)18-20-44(28(7)8,29(9)10)30(11)12/h13-16,21-30H,1-12H3 |
| InChIKey | NXTFNXVSDWWNTD-UHFFFAOYSA-N |
| XLogP | 13.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.82 |
| LogP ≤ 5 | 13.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|