About 2,8-dibromochrysene
2,8-dibromochrysene (PubChem CID 3016536) has the molecular formula C18H10Br2
and a molecular weight of 386.09 g/mol. Its IUPAC name is 2,8-dibromochrysene.
Molecular Properties
| Compound Name | 2,8-dibromochrysene |
| PubChem CID | 3016536 |
| Molecular Formula | C18H10Br2 |
| Molecular Weight | 386.09 g/mol |
| Exact Mass | 383.91 |
| IUPAC Name | 2,8-dibromochrysene |
| SMILES | Brc1ccc2c(ccc3c4ccc(Br)cc4ccc23)c1 |
| InChI | InChI=1S/C18H10Br2/c19-13-3-7-15-11(9-13)1-5-17-16-8-4-14(20)10-12(16)2-6-18(15)17/h1-10H |
| InChIKey | WTZGPARNWJTIBL-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.09 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2,8-dibromochrysene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dibromochrysene?
The IUPAC name of 2,8-dibromochrysene (CID 3016536) is 2,8-dibromochrysene.
What is the SMILES notation for 2,8-dibromochrysene?
The canonical SMILES for 2,8-dibromochrysene is Brc1ccc2c(ccc3c4ccc(Br)cc4ccc23)c1.
What is the InChIKey of 2,8-dibromochrysene?
The InChIKey is WTZGPARNWJTIBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10Br2/c19-13-3-7-15-11(9-13)1-5-17-16-8-4-14(20)10-12(16)2-6-18(15)17/h1-10H.
What are the key properties of 2,8-dibromochrysene?
2,8-dibromochrysene has a molecular weight of 386.09 g/mol, XLogP of 6.67, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dibromochrysene is sourced from PubChem (CID 3016536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).