C36H46Br4Si2 — CID 134954086
tri(propan-2-yl)-[2-[2,3,6,7-tetrabromo-10-[2-tri(propan-2-yl)silylethynyl]anthracen-9-yl]ethynyl]silane (PubChem CID 134954086) has the molecular formula C36H46Br4Si2 and a molecular weight of 854.55 g/mol. Its IUPAC name is tri(propan-2-yl)-[2-[2,3,6,7-tetrabromo-10-[2-tri(propan-2-yl)silylethynyl]anthracen-9-yl]ethynyl]silane.
| Compound Name | tri(propan-2-yl)-[2-[2,3,6,7-tetrabromo-10-[2-tri(propan-2-yl)silylethynyl]anthracen-9-yl]ethynyl]silane |
|---|---|
| PubChem CID | 134954086 |
| Molecular Formula | C36H46Br4Si2 |
| Molecular Weight | 854.55 g/mol |
| Exact Mass | 849.99 |
| IUPAC Name | tri(propan-2-yl)-[2-[2,3,6,7-tetrabromo-10-[2-tri(propan-2-yl)silylethynyl]anthracen-9-yl]ethynyl]silane |
| SMILES | CC(C)[Si](C#Cc1c2cc(Br)c(Br)cc2c(C#C[Si](C(C)C)(C(C)C)C(C)C)c2cc(Br)c(Br)cc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H46Br4Si2/c1-21(2)41(22(3)4,23(5)6)15-13-27-29-17-33(37)35(39)19-31(29)28(32-20-36(40)34(38)18-30(27)32)14-16-42(24(7)8,25(9)10)26(11)12/h17-26H,1-12H3 |
| InChIKey | FJHRUMZKZGTJGH-UHFFFAOYSA-N |
| XLogP | 14.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.55 |
| LogP ≤ 5 | 14.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|