C21H22Br2I2N2 — CID 102026725
1,3-dibromo-5-tert-butyl-2-[(4-tert-butyl-2,6-diiodophenyl)-diazomethyl]benzene (PubChem CID 102026725) has the molecular formula C21H22Br2I2N2 and a molecular weight of 716.04 g/mol. Its IUPAC name is 1,3-dibromo-5-tert-butyl-2-[(4-tert-butyl-2,6-diiodophenyl)-diazomethyl]benzene.
| Compound Name | 1,3-dibromo-5-tert-butyl-2-[(4-tert-butyl-2,6-diiodophenyl)-diazomethyl]benzene |
|---|---|
| PubChem CID | 102026725 |
| Molecular Formula | C21H22Br2I2N2 |
| Molecular Weight | 716.04 g/mol |
| Exact Mass | 713.82 |
| IUPAC Name | 1,3-dibromo-5-tert-butyl-2-[(4-tert-butyl-2,6-diiodophenyl)-diazomethyl]benzene |
| SMILES | CC(C)(C)c1cc(Br)c(C(=[N+]=[N-])c2c(I)cc(C(C)(C)C)cc2I)c(Br)c1 |
| InChI | InChI=1S/C21H22Br2I2N2/c1-20(2,3)11-7-13(22)17(14(23)8-11)19(27-26)18-15(24)9-12(10-16(18)25)21(4,5)6/h7-10H,1-6H3 |
| InChIKey | RFYGURYRROKDSN-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.04 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|