C21H22Br2N2 — CID 102356062
1,3-dibromo-2-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]-5-ethenylbenzene (PubChem CID 102356062) has the molecular formula C21H22Br2N2 and a molecular weight of 462.23 g/mol. Its IUPAC name is 1,3-dibromo-2-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]-5-ethenylbenzene.
| Compound Name | 1,3-dibromo-2-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]-5-ethenylbenzene |
|---|---|
| PubChem CID | 102356062 |
| Molecular Formula | C21H22Br2N2 |
| Molecular Weight | 462.23 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | 1,3-dibromo-2-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]-5-ethenylbenzene |
| SMILES | C=Cc1cc(Br)c(C(=[N+]=[N-])c2c(C)cc(C(C)(C)C)cc2C)c(Br)c1 |
| InChI | InChI=1S/C21H22Br2N2/c1-7-14-10-16(22)19(17(23)11-14)20(25-24)18-12(2)8-15(9-13(18)3)21(4,5)6/h7-11H,1H2,2-6H3 |
| InChIKey | BKYAXAPCUNVHGE-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.23 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|