C24H30Br2Si — CID 23231233
2-[3,5-dibromo-4-[(4-tert-butyl-2,6-dimethylphenyl)methyl]phenyl]ethynyl-trimethylsilane (PubChem CID 23231233) has the molecular formula C24H30Br2Si and a molecular weight of 506.40 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-[(4-tert-butyl-2,6-dimethylphenyl)methyl]phenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[3,5-dibromo-4-[(4-tert-butyl-2,6-dimethylphenyl)methyl]phenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 23231233 |
| Molecular Formula | C24H30Br2Si |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | 2-[3,5-dibromo-4-[(4-tert-butyl-2,6-dimethylphenyl)methyl]phenyl]ethynyl-trimethylsilane |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1Cc1c(Br)cc(C#C[Si](C)(C)C)cc1Br |
| InChI | InChI=1S/C24H30Br2Si/c1-16-11-19(24(3,4)5)12-17(2)20(16)15-21-22(25)13-18(14-23(21)26)9-10-27(6,7)8/h11-14H,15H2,1-8H3 |
| InChIKey | BBMKZESKKBCFOF-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|