C19H15BrF6N2 — CID 101183377
2-[(4-bromophenyl)-diazomethyl]-5-tert-butyl-1,3-bis(trifluoromethyl)benzene (PubChem CID 101183377) has the molecular formula C19H15BrF6N2 and a molecular weight of 465.24 g/mol. Its IUPAC name is 2-[(4-bromophenyl)-diazomethyl]-5-tert-butyl-1,3-bis(trifluoromethyl)benzene.
| Compound Name | 2-[(4-bromophenyl)-diazomethyl]-5-tert-butyl-1,3-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 101183377 |
| Molecular Formula | C19H15BrF6N2 |
| Molecular Weight | 465.24 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | 2-[(4-bromophenyl)-diazomethyl]-5-tert-butyl-1,3-bis(trifluoromethyl)benzene |
| SMILES | CC(C)(C)c1cc(C(F)(F)F)c(C(=[N+]=[N-])c2ccc(Br)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15BrF6N2/c1-17(2,3)11-8-13(18(21,22)23)15(14(9-11)19(24,25)26)16(28-27)10-4-6-12(20)7-5-10/h4-9H,1-3H3 |
| InChIKey | BEAFDAMAIWJMKR-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.24 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|