C28H37NO3Si — CID 101184737
(4S)-3-[(4R)-4-hydroxy-3-trimethylsilylhepta-1,2-dienyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 101184737) has the molecular formula C28H37NO3Si and a molecular weight of 463.69 g/mol. Its IUPAC name is (4S)-3-[(4R)-4-hydroxy-3-trimethylsilylhepta-1,2-dienyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(4R)-4-hydroxy-3-trimethylsilylhepta-1,2-dienyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101184737 |
| Molecular Formula | C28H37NO3Si |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | (4S)-3-[(4R)-4-hydroxy-3-trimethylsilylhepta-1,2-dienyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CCC[C@@H](O)C(=C=CN1C(=O)OC(c2ccccc2)(c2ccccc2)[C@@H]1C(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C28H37NO3Si/c1-7-14-24(30)25(33(4,5)6)19-20-29-26(21(2)3)28(32-27(29)31,22-15-10-8-11-16-22)23-17-12-9-13-18-23/h8-13,15-18,20-21,24,26,30H,7,14H2,1-6H3/t19?,24-,26+/m1/s1 |
| InChIKey | PIVBLDSXYNPAKL-YMINUMGASA-N |
| XLogP | 6.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|