C15H25NO10 — CID 101185162
N-[(1S,3S,5R,6R,7S,8R,11R,13R,14R,15R)-6,7,15-trihydroxy-5-(hydroxymethyl)-13-methoxy-2,4,9,12-tetraoxatricyclo[9.4.0.03,8]pentadecan-14-yl]acetamide (PubChem CID 101185162) has the molecular formula C15H25NO10 and a molecular weight of 379.36 g/mol. Its IUPAC name is N-[(1S,3S,5R,6R,7S,8R,11R,13R,14R,15R)-6,7,15-trihydroxy-5-(hydroxymethyl)-13-methoxy-2,4,9,12-tetraoxatricyclo[9.4.0.03,8]pentadecan-14-yl]acetamide.
| Compound Name | N-[(1S,3S,5R,6R,7S,8R,11R,13R,14R,15R)-6,7,15-trihydroxy-5-(hydroxymethyl)-13-methoxy-2,4,9,12-tetraoxatricyclo[9.4.0.03,8]pentadecan-14-yl]acetamide |
|---|---|
| PubChem CID | 101185162 |
| Molecular Formula | C15H25NO10 |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[(1S,3S,5R,6R,7S,8R,11R,13R,14R,15R)-6,7,15-trihydroxy-5-(hydroxymethyl)-13-methoxy-2,4,9,12-tetraoxatricyclo[9.4.0.03,8]pentadecan-14-yl]acetamide |
| SMILES | CO[C@@H]1O[C@@H]2CO[C@H]3[C@H](O[C@H]2[C@H](O)[C@H]1NC(C)=O)O[C@H](CO)[C@H](O)[C@@H]3O |
| InChI | InChI=1S/C15H25NO10/c1-5(18)16-8-10(20)12-7(25-14(8)22-2)4-23-13-11(21)9(19)6(3-17)24-15(13)26-12/h6-15,17,19-21H,3-4H2,1-2H3,(H,16,18)/t6-,7-,8-,9+,10-,11+,12-,13-,14-,15+/m1/s1 |
| InChIKey | CQDHWFWFVLBSAM-AEBMIEDASA-N |
| XLogP | -3.55 |
| TPSA | 156.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |