C24H19F3N4O4S — CID 10118633
N-hydroxy-4-[(4-methylphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-7-(trifluoromethyl)quinoline-3-carboxamide (PubChem CID 10118633) has the molecular formula C24H19F3N4O4S and a molecular weight of 516.50 g/mol. Its IUPAC name is N-hydroxy-4-[(4-methylphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-7-(trifluoromethyl)quinoline-3-carboxamide.
| Compound Name | N-hydroxy-4-[(4-methylphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-7-(trifluoromethyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 10118633 |
| Molecular Formula | C24H19F3N4O4S |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | N-hydroxy-4-[(4-methylphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-7-(trifluoromethyl)quinoline-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2cccnc2)c2c(C(=O)NO)cnc3cc(C(F)(F)F)ccc23)cc1 |
| InChI | InChI=1S/C24H19F3N4O4S/c1-15-4-7-18(8-5-15)36(34,35)31(14-16-3-2-10-28-12-16)22-19-9-6-17(24(25,26)27)11-21(19)29-13-20(22)23(32)30-33/h2-13,33H,14H2,1H3,(H,30,32) |
| InChIKey | NKZQXGVLDOUMQF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|