C15H22O6 — CID 101187069
ethyl 1-[(Z)-2,4-dimethoxy-4-oxobut-2-enyl]-2-oxocyclohexane-1-carboxylate (PubChem CID 101187069) has the molecular formula C15H22O6 and a molecular weight of 298.33 g/mol. Its IUPAC name is ethyl 1-[(Z)-2,4-dimethoxy-4-oxobut-2-enyl]-2-oxocyclohexane-1-carboxylate.
| Compound Name | ethyl 1-[(Z)-2,4-dimethoxy-4-oxobut-2-enyl]-2-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 101187069 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | ethyl 1-[(Z)-2,4-dimethoxy-4-oxobut-2-enyl]-2-oxocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(C/C(=C/C(=O)OC)OC)CCCCC1=O |
| InChI | InChI=1S/C15H22O6/c1-4-21-14(18)15(8-6-5-7-12(15)16)10-11(19-2)9-13(17)20-3/h9H,4-8,10H2,1-3H3/b11-9- |
| InChIKey | ODBMKRRPULJVKJ-LUAWRHEFSA-N |
| XLogP | 1.77 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|