About triethyl-[(2R)-1,1,1-trichloropent-4-yn-2-yl]oxysilane
triethyl-[(2R)-1,1,1-trichloropent-4-yn-2-yl]oxysilane (PubChem CID 101187830) has the molecular formula C11H19Cl3OSi
and a molecular weight of 301.72 g/mol. Its IUPAC name is triethyl-[(2R)-1,1,1-trichloropent-4-yn-2-yl]oxysilane.
Molecular Properties
| Compound Name | triethyl-[(2R)-1,1,1-trichloropent-4-yn-2-yl]oxysilane |
| PubChem CID | 101187830 |
| Molecular Formula | C11H19Cl3OSi |
| Molecular Weight | 301.72 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | triethyl-[(2R)-1,1,1-trichloropent-4-yn-2-yl]oxysilane |
| SMILES | C#CC[C@@H](O[Si](CC)(CC)CC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H19Cl3OSi/c1-5-9-10(11(12,13)14)15-16(6-2,7-3)8-4/h1,10H,6-9H2,2-4H3/t10-/m1/s1 |
| InChIKey | ORPAYLFPESFYQG-SNVBAGLBSA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.72 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(2R)-1,1,1-trichloropent-4-yn-2-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(2R)-1,1,1-trichloropent-4-yn-2-yl]oxysilane?
The IUPAC name of triethyl-[(2R)-1,1,1-trichloropent-4-yn-2-yl]oxysilane (CID 101187830) is triethyl-[(2R)-1,1,1-trichloropent-4-yn-2-yl]oxysilane.
What is the SMILES notation for triethyl-[(2R)-1,1,1-trichloropent-4-yn-2-yl]oxysilane?
The canonical SMILES for triethyl-[(2R)-1,1,1-trichloropent-4-yn-2-yl]oxysilane is C#CC[C@@H](O[Si](CC)(CC)CC)C(Cl)(Cl)Cl.
What is the InChIKey of triethyl-[(2R)-1,1,1-trichloropent-4-yn-2-yl]oxysilane?
The InChIKey is ORPAYLFPESFYQG-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H19Cl3OSi/c1-5-9-10(11(12,13)14)15-16(6-2,7-3)8-4/h1,10H,6-9H2,2-4H3/t10-/m1/s1.
What are the key properties of triethyl-[(2R)-1,1,1-trichloropent-4-yn-2-yl]oxysilane?
triethyl-[(2R)-1,1,1-trichloropent-4-yn-2-yl]oxysilane has a molecular weight of 301.72 g/mol, XLogP of 4.77, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(2R)-1,1,1-trichloropent-4-yn-2-yl]oxysilane is sourced from PubChem (CID 101187830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).