About methyl 2-[phenylimino-di(propan-2-yl)-λ5-phosphanyl]acetate
methyl 2-[phenylimino-di(propan-2-yl)-λ5-phosphanyl]acetate (PubChem CID 101188334) has the molecular formula C15H24NO2P
and a molecular weight of 281.34 g/mol. Its IUPAC name is methyl 2-[phenylimino-di(propan-2-yl)-λ5-phosphanyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[phenylimino-di(propan-2-yl)-λ5-phosphanyl]acetate |
| PubChem CID | 101188334 |
| Molecular Formula | C15H24NO2P |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | methyl 2-[phenylimino-di(propan-2-yl)-λ5-phosphanyl]acetate |
| SMILES | COC(=O)CP(=Nc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C15H24NO2P/c1-12(2)19(13(3)4,11-15(17)18-5)16-14-9-7-6-8-10-14/h6-10,12-13H,11H2,1-5H3 |
| InChIKey | SKDZLHFSHUSQEY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[phenylimino-di(propan-2-yl)-λ5-phosphanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[phenylimino-di(propan-2-yl)-λ5-phosphanyl]acetate?
The IUPAC name of methyl 2-[phenylimino-di(propan-2-yl)-λ5-phosphanyl]acetate (CID 101188334) is methyl 2-[phenylimino-di(propan-2-yl)-λ5-phosphanyl]acetate.
What is the SMILES notation for methyl 2-[phenylimino-di(propan-2-yl)-λ5-phosphanyl]acetate?
The canonical SMILES for methyl 2-[phenylimino-di(propan-2-yl)-λ5-phosphanyl]acetate is COC(=O)CP(=Nc1ccccc1)(C(C)C)C(C)C.
What is the InChIKey of methyl 2-[phenylimino-di(propan-2-yl)-λ5-phosphanyl]acetate?
The InChIKey is SKDZLHFSHUSQEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24NO2P/c1-12(2)19(13(3)4,11-15(17)18-5)16-14-9-7-6-8-10-14/h6-10,12-13H,11H2,1-5H3.
What are the key properties of methyl 2-[phenylimino-di(propan-2-yl)-λ5-phosphanyl]acetate?
methyl 2-[phenylimino-di(propan-2-yl)-λ5-phosphanyl]acetate has a molecular weight of 281.34 g/mol, XLogP of 4.51, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[phenylimino-di(propan-2-yl)-λ5-phosphanyl]acetate is sourced from PubChem (CID 101188334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).